C20H22N4O2 — CID 112861116
4-N-(3,4-dimethoxyphenyl)-6-N-(2-phenylethyl)pyrimidine-4,6-diamine (PubChem CID 112861116) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-N-(3,4-dimethoxyphenyl)-6-N-(2-phenylethyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3,4-dimethoxyphenyl)-6-N-(2-phenylethyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112861116 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-N-(3,4-dimethoxyphenyl)-6-N-(2-phenylethyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2cc(NCCc3ccccc3)ncn2)cc1OC |
| InChI | InChI=1S/C20H22N4O2/c1-25-17-9-8-16(12-18(17)26-2)24-20-13-19(22-14-23-20)21-11-10-15-6-4-3-5-7-15/h3-9,12-14H,10-11H2,1-2H3,(H2,21,22,23,24) |
| InChIKey | WCAWKEUKBUHRJO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |