C19H27N7 — CID 112863363
N-cycloheptyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine (PubChem CID 112863363) has the molecular formula C19H27N7 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-cycloheptyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine.
| Compound Name | N-cycloheptyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112863363 |
| Molecular Formula | C19H27N7 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.23 |
| IUPAC Name | N-cycloheptyl-6-(4-pyrimidin-2-ylpiperazin-1-yl)pyrimidin-4-amine |
| SMILES | c1cnc(N2CCN(c3cc(NC4CCCCCC4)ncn3)CC2)nc1 |
| InChI | InChI=1S/C19H27N7/c1-2-4-7-16(6-3-1)24-17-14-18(23-15-22-17)25-10-12-26(13-11-25)19-20-8-5-9-21-19/h5,8-9,14-16H,1-4,6-7,10-13H2,(H,22,23,24) |
| InChIKey | XYACCVNDEVOUQC-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 70.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |