C15H19FN4 — CID 112864011
4-N-(4-fluorophenyl)-6-N-(3-methylbutyl)pyrimidine-4,6-diamine (PubChem CID 112864011) has the molecular formula C15H19FN4 and a molecular weight of 274.34 g/mol. Its IUPAC name is 4-N-(4-fluorophenyl)-6-N-(3-methylbutyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(4-fluorophenyl)-6-N-(3-methylbutyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112864011 |
| Molecular Formula | C15H19FN4 |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 4-N-(4-fluorophenyl)-6-N-(3-methylbutyl)pyrimidine-4,6-diamine |
| SMILES | CC(C)CCNc1cc(Nc2ccc(F)cc2)ncn1 |
| InChI | InChI=1S/C15H19FN4/c1-11(2)7-8-17-14-9-15(19-10-18-14)20-13-5-3-12(16)4-6-13/h3-6,9-11H,7-8H2,1-2H3,(H2,17,18,19,20) |
| InChIKey | XHTMRTDLZOENFI-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |