C18H22N4O2 — CID 112864365
N-(1,3-benzodioxol-5-yl)-6-(2-ethylpiperidin-1-yl)pyrimidin-4-amine (PubChem CID 112864365) has the molecular formula C18H22N4O2 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-6-(2-ethylpiperidin-1-yl)pyrimidin-4-amine.
| Compound Name | N-(1,3-benzodioxol-5-yl)-6-(2-ethylpiperidin-1-yl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112864365 |
| Molecular Formula | C18H22N4O2 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-6-(2-ethylpiperidin-1-yl)pyrimidin-4-amine |
| SMILES | CCC1CCCCN1c1cc(Nc2ccc3c(c2)OCO3)ncn1 |
| InChI | InChI=1S/C18H22N4O2/c1-2-14-5-3-4-8-22(14)18-10-17(19-11-20-18)21-13-6-7-15-16(9-13)24-12-23-15/h6-7,9-11,14H,2-5,8,12H2,1H3,(H,19,20,21) |
| InChIKey | LLMMVFCXYZPFLA-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |