1,2-oxazole-3-carboxylic acid

C4H3NO3 — CID 11286453

IUPAC1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1ccon1
InChIInChI=1S/C4H3NO3/c6-4(7)3-1-2-8-5-3/h1-2H,(H,6,7)
InChIKeyUXYRXGFUANQKTA-UHFFFAOYSA-N
MW113.07 g/mol
LogP0.37
Rot. Bonds1

About 1,2-oxazole-3-carboxylic acid

1,2-oxazole-3-carboxylic acid (PubChem CID 11286453) has the molecular formula C4H3NO3 and a molecular weight of 113.07 g/mol. Its IUPAC name is 1,2-oxazole-3-carboxylic acid.

Molecular Properties

Compound Name1,2-oxazole-3-carboxylic acid
PubChem CID11286453
Molecular FormulaC4H3NO3
Molecular Weight113.07 g/mol
Exact Mass113.01
IUPAC Name1,2-oxazole-3-carboxylic acid
SMILESO=C(O)c1ccon1
InChIInChI=1S/C4H3NO3/c6-4(7)3-1-2-8-5-3/h1-2H,(H,6,7)
InChIKeyUXYRXGFUANQKTA-UHFFFAOYSA-N
XLogP0.37
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500113.07
LogP ≤ 50.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1,2-oxazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,2-oxazole-3-carboxylic acid?
The IUPAC name of 1,2-oxazole-3-carboxylic acid (CID 11286453) is 1,2-oxazole-3-carboxylic acid.
What is the SMILES notation for 1,2-oxazole-3-carboxylic acid?
The canonical SMILES for 1,2-oxazole-3-carboxylic acid is O=C(O)c1ccon1.
What is the InChIKey of 1,2-oxazole-3-carboxylic acid?
The InChIKey is UXYRXGFUANQKTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3NO3/c6-4(7)3-1-2-8-5-3/h1-2H,(H,6,7).
What are the key properties of 1,2-oxazole-3-carboxylic acid?
1,2-oxazole-3-carboxylic acid has a molecular weight of 113.07 g/mol, XLogP of 0.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-oxazole-3-carboxylic acid is sourced from PubChem (CID 11286453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).