C7H8N2O — CID 11286491
5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carbaldehyde (PubChem CID 11286491) has the molecular formula C7H8N2O and a molecular weight of 136.15 g/mol. Its IUPAC name is 5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carbaldehyde.
| Compound Name | 5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carbaldehyde |
|---|---|
| PubChem CID | 11286491 |
| Molecular Formula | C7H8N2O |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.06 |
| IUPAC Name | 5,6-dihydro-4H-pyrrolo[2,1-e]pyrazole-2-carbaldehyde |
| SMILES | O=Cc1cc2n(n1)CCC2 |
| InChI | InChI=1S/C7H8N2O/c10-5-6-4-7-2-1-3-9(7)8-6/h4-5H,1-3H2 |
| InChIKey | RTZLJDDSFCFBML-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|