C21H22ClN5O — CID 112866020
4-N-(3-chloro-4-methoxyphenyl)-6-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine (PubChem CID 112866020) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is 4-N-(3-chloro-4-methoxyphenyl)-6-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine.
| Compound Name | 4-N-(3-chloro-4-methoxyphenyl)-6-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112866020 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 4-N-(3-chloro-4-methoxyphenyl)-6-N-(4-pyrrolidin-1-ylphenyl)pyrimidine-4,6-diamine |
| SMILES | COc1ccc(Nc2cc(Nc3ccc(N4CCCC4)cc3)ncn2)cc1Cl |
| InChI | InChI=1S/C21H22ClN5O/c1-28-19-9-6-16(12-18(19)22)26-21-13-20(23-14-24-21)25-15-4-7-17(8-5-15)27-10-2-3-11-27/h4-9,12-14H,2-3,10-11H2,1H3,(H2,23,24,25,26) |
| InChIKey | JDVZUEGHURSJIX-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|