C11H20O — CID 11286698
(6E)-8-propan-2-yloxyocta-1,6-diene (PubChem CID 11286698) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (6E)-8-propan-2-yloxyocta-1,6-diene.
| Compound Name | (6E)-8-propan-2-yloxyocta-1,6-diene |
|---|---|
| PubChem CID | 11286698 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (6E)-8-propan-2-yloxyocta-1,6-diene |
| SMILES | C=CCCC/C=C/COC(C)C |
| InChI | InChI=1S/C11H20O/c1-4-5-6-7-8-9-10-12-11(2)3/h4,8-9,11H,1,5-7,10H2,2-3H3/b9-8+ |
| InChIKey | BNRONWJZMWMPBK-CMDGGOBGSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|