About (5Z)-6,10-dimethylundeca-5,9-dien-1-yne
(5Z)-6,10-dimethylundeca-5,9-dien-1-yne (PubChem CID 11286780) has the molecular formula C13H20
and a molecular weight of 176.30 g/mol. Its IUPAC name is (5Z)-6,10-dimethylundeca-5,9-dien-1-yne.
Molecular Properties
| Compound Name | (5Z)-6,10-dimethylundeca-5,9-dien-1-yne |
| PubChem CID | 11286780 |
| Molecular Formula | C13H20 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.16 |
| IUPAC Name | (5Z)-6,10-dimethylundeca-5,9-dien-1-yne |
| SMILES | C#CCC/C=C(/C)CCC=C(C)C |
| InChI | InChI=1S/C13H20/c1-5-6-7-10-13(4)11-8-9-12(2)3/h1,9-10H,6-8,11H2,2-4H3/b13-10- |
| InChIKey | GNOQEXWKRHKDKA-RAXLEYEMSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (5Z)-6,10-dimethylundeca-5,9-dien-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-6,10-dimethylundeca-5,9-dien-1-yne?
The IUPAC name of (5Z)-6,10-dimethylundeca-5,9-dien-1-yne (CID 11286780) is (5Z)-6,10-dimethylundeca-5,9-dien-1-yne.
What is the SMILES notation for (5Z)-6,10-dimethylundeca-5,9-dien-1-yne?
The canonical SMILES for (5Z)-6,10-dimethylundeca-5,9-dien-1-yne is C#CCC/C=C(/C)CCC=C(C)C.
What is the InChIKey of (5Z)-6,10-dimethylundeca-5,9-dien-1-yne?
The InChIKey is GNOQEXWKRHKDKA-RAXLEYEMSA-N. The full InChI is InChI=1S/C13H20/c1-5-6-7-10-13(4)11-8-9-12(2)3/h1,9-10H,6-8,11H2,2-4H3/b13-10-.
What are the key properties of (5Z)-6,10-dimethylundeca-5,9-dien-1-yne?
(5Z)-6,10-dimethylundeca-5,9-dien-1-yne has a molecular weight of 176.30 g/mol, XLogP of 4.09, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-6,10-dimethylundeca-5,9-dien-1-yne is sourced from PubChem (CID 11286780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).