About 1-(4-fluorophenyl)ethyl acetate
1-(4-fluorophenyl)ethyl acetate (PubChem CID 11286838) has the molecular formula C10H11FO2
and a molecular weight of 182.19 g/mol. Its IUPAC name is 1-(4-fluorophenyl)ethyl acetate.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)ethyl acetate |
| PubChem CID | 11286838 |
| Molecular Formula | C10H11FO2 |
| Molecular Weight | 182.19 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 1-(4-fluorophenyl)ethyl acetate |
| SMILES | CC(=O)OC(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H11FO2/c1-7(13-8(2)12)9-3-5-10(11)6-4-9/h3-7H,1-2H3 |
| InChIKey | HPRCHGOIZZMEMQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.19 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluorophenyl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)ethyl acetate?
The IUPAC name of 1-(4-fluorophenyl)ethyl acetate (CID 11286838) is 1-(4-fluorophenyl)ethyl acetate.
What is the SMILES notation for 1-(4-fluorophenyl)ethyl acetate?
The canonical SMILES for 1-(4-fluorophenyl)ethyl acetate is CC(=O)OC(C)c1ccc(F)cc1.
What is the InChIKey of 1-(4-fluorophenyl)ethyl acetate?
The InChIKey is HPRCHGOIZZMEMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO2/c1-7(13-8(2)12)9-3-5-10(11)6-4-9/h3-7H,1-2H3.
What are the key properties of 1-(4-fluorophenyl)ethyl acetate?
1-(4-fluorophenyl)ethyl acetate has a molecular weight of 182.19 g/mol, XLogP of 2.45, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)ethyl acetate is sourced from PubChem (CID 11286838), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).