About ethyl 2-acetylhexa-4,5-dienoate
ethyl 2-acetylhexa-4,5-dienoate (PubChem CID 11286842) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is ethyl 2-acetylhexa-4,5-dienoate.
Molecular Properties
| Compound Name | ethyl 2-acetylhexa-4,5-dienoate |
| PubChem CID | 11286842 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | ethyl 2-acetylhexa-4,5-dienoate |
| SMILES | C=C=CCC(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C10H14O3/c1-4-6-7-9(8(3)11)10(12)13-5-2/h6,9H,1,5,7H2,2-3H3 |
| InChIKey | ZCSKIMFJKSFTNO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-acetylhexa-4,5-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-acetylhexa-4,5-dienoate?
The IUPAC name of ethyl 2-acetylhexa-4,5-dienoate (CID 11286842) is ethyl 2-acetylhexa-4,5-dienoate.
What is the SMILES notation for ethyl 2-acetylhexa-4,5-dienoate?
The canonical SMILES for ethyl 2-acetylhexa-4,5-dienoate is C=C=CCC(C(C)=O)C(=O)OCC.
What is the InChIKey of ethyl 2-acetylhexa-4,5-dienoate?
The InChIKey is ZCSKIMFJKSFTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c1-4-6-7-9(8(3)11)10(12)13-5-2/h6,9H,1,5,7H2,2-3H3.
What are the key properties of ethyl 2-acetylhexa-4,5-dienoate?
ethyl 2-acetylhexa-4,5-dienoate has a molecular weight of 182.22 g/mol, XLogP of 1.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-acetylhexa-4,5-dienoate is sourced from PubChem (CID 11286842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).