C15H16Cl2N4 — CID 112868580
N-(3,5-dichlorophenyl)-2-methyl-6-pyrrolidin-1-ylpyrimidin-4-amine (PubChem CID 112868580) has the molecular formula C15H16Cl2N4 and a molecular weight of 323.23 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-methyl-6-pyrrolidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(3,5-dichlorophenyl)-2-methyl-6-pyrrolidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112868580 |
| Molecular Formula | C15H16Cl2N4 |
| Molecular Weight | 323.23 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-methyl-6-pyrrolidin-1-ylpyrimidin-4-amine |
| SMILES | Cc1nc(Nc2cc(Cl)cc(Cl)c2)cc(N2CCCC2)n1 |
| InChI | InChI=1S/C15H16Cl2N4/c1-10-18-14(9-15(19-10)21-4-2-3-5-21)20-13-7-11(16)6-12(17)8-13/h6-9H,2-5H2,1H3,(H,18,19,20) |
| InChIKey | VSEPSDRADMKRNO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.23 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |