C18H24N4O — CID 112868907
N-(2-ethoxyphenyl)-2-methyl-6-piperidin-1-ylpyrimidin-4-amine (PubChem CID 112868907) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-2-methyl-6-piperidin-1-ylpyrimidin-4-amine.
| Compound Name | N-(2-ethoxyphenyl)-2-methyl-6-piperidin-1-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112868907 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | N-(2-ethoxyphenyl)-2-methyl-6-piperidin-1-ylpyrimidin-4-amine |
| SMILES | CCOc1ccccc1Nc1cc(N2CCCCC2)nc(C)n1 |
| InChI | InChI=1S/C18H24N4O/c1-3-23-16-10-6-5-9-15(16)21-17-13-18(20-14(2)19-17)22-11-7-4-8-12-22/h5-6,9-10,13H,3-4,7-8,11-12H2,1-2H3,(H,19,20,21) |
| InChIKey | BIWTZECACRJPQT-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |