C13H16O — CID 11286929
5-[2-(cyclohexen-1-yl)ethynyl]-3,4-dihydro-2H-pyran (PubChem CID 11286929) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 5-[2-(cyclohexen-1-yl)ethynyl]-3,4-dihydro-2H-pyran.
| Compound Name | 5-[2-(cyclohexen-1-yl)ethynyl]-3,4-dihydro-2H-pyran |
|---|---|
| PubChem CID | 11286929 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 5-[2-(cyclohexen-1-yl)ethynyl]-3,4-dihydro-2H-pyran |
| SMILES | C(#CC1=COCCC1)C1=CCCCC1 |
| InChI | InChI=1S/C13H16O/c1-2-5-12(6-3-1)8-9-13-7-4-10-14-11-13/h5,11H,1-4,6-7,10H2 |
| InChIKey | LUYLXIOZTXXPIL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|