C18H26N4O — CID 112869548
4-N-(2-tert-butylphenyl)-6-N-(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 112869548) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 4-N-(2-tert-butylphenyl)-6-N-(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-tert-butylphenyl)-6-N-(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112869548 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 4-N-(2-tert-butylphenyl)-6-N-(2-methoxyethyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | COCCNc1cc(Nc2ccccc2C(C)(C)C)nc(C)n1 |
| InChI | InChI=1S/C18H26N4O/c1-13-20-16(19-10-11-23-5)12-17(21-13)22-15-9-7-6-8-14(15)18(2,3)4/h6-9,12H,10-11H2,1-5H3,(H2,19,20,21,22) |
| InChIKey | XXSBEWJHTFEJRW-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|