C12H18O2 — CID 11287015
(3aS,7aR)-6-methylspiro[1,2,3a,4,7,7a-hexahydroindene-3,2'-1,3-dioxolane] (PubChem CID 11287015) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3aS,7aR)-6-methylspiro[1,2,3a,4,7,7a-hexahydroindene-3,2'-1,3-dioxolane].
| Compound Name | (3aS,7aR)-6-methylspiro[1,2,3a,4,7,7a-hexahydroindene-3,2'-1,3-dioxolane] |
|---|---|
| PubChem CID | 11287015 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3aS,7aR)-6-methylspiro[1,2,3a,4,7,7a-hexahydroindene-3,2'-1,3-dioxolane] |
| SMILES | CC1=CC[C@H]2[C@H](CCC23OCCO3)C1 |
| InChI | InChI=1S/C12H18O2/c1-9-2-3-11-10(8-9)4-5-12(11)13-6-7-14-12/h2,10-11H,3-8H2,1H3/t10-,11+/m1/s1 |
| InChIKey | AUWJLVYXTZECMH-MNOVXSKESA-N |
| XLogP | 2.50 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|