About 4-phenylsulfanyl-1,3-dioxolan-2-one
4-phenylsulfanyl-1,3-dioxolan-2-one (PubChem CID 11287057) has the molecular formula C9H8O3S
and a molecular weight of 196.23 g/mol. Its IUPAC name is 4-phenylsulfanyl-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-phenylsulfanyl-1,3-dioxolan-2-one |
| PubChem CID | 11287057 |
| Molecular Formula | C9H8O3S |
| Molecular Weight | 196.23 g/mol |
| Exact Mass | 196.02 |
| IUPAC Name | 4-phenylsulfanyl-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(Sc2ccccc2)O1 |
| InChI | InChI=1S/C9H8O3S/c10-9-11-6-8(12-9)13-7-4-2-1-3-5-7/h1-5,8H,6H2 |
| InChIKey | RGKJPSUIRWDBRT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-phenylsulfanyl-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylsulfanyl-1,3-dioxolan-2-one?
The IUPAC name of 4-phenylsulfanyl-1,3-dioxolan-2-one (CID 11287057) is 4-phenylsulfanyl-1,3-dioxolan-2-one.
What is the SMILES notation for 4-phenylsulfanyl-1,3-dioxolan-2-one?
The canonical SMILES for 4-phenylsulfanyl-1,3-dioxolan-2-one is O=C1OCC(Sc2ccccc2)O1.
What is the InChIKey of 4-phenylsulfanyl-1,3-dioxolan-2-one?
The InChIKey is RGKJPSUIRWDBRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S/c10-9-11-6-8(12-9)13-7-4-2-1-3-5-7/h1-5,8H,6H2.
What are the key properties of 4-phenylsulfanyl-1,3-dioxolan-2-one?
4-phenylsulfanyl-1,3-dioxolan-2-one has a molecular weight of 196.23 g/mol, XLogP of 2.27, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylsulfanyl-1,3-dioxolan-2-one is sourced from PubChem (CID 11287057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).