C18H24BrN5 — CID 112870959
N-(4-bromo-2-methylphenyl)-6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-amine (PubChem CID 112870959) has the molecular formula C18H24BrN5 and a molecular weight of 390.33 g/mol. Its IUPAC name is N-(4-bromo-2-methylphenyl)-6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-amine.
| Compound Name | N-(4-bromo-2-methylphenyl)-6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112870959 |
| Molecular Formula | C18H24BrN5 |
| Molecular Weight | 390.33 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | N-(4-bromo-2-methylphenyl)-6-(4-ethylpiperazin-1-yl)-2-methylpyrimidin-4-amine |
| SMILES | CCN1CCN(c2cc(Nc3ccc(Br)cc3C)nc(C)n2)CC1 |
| InChI | InChI=1S/C18H24BrN5/c1-4-23-7-9-24(10-8-23)18-12-17(20-14(3)21-18)22-16-6-5-15(19)11-13(16)2/h5-6,11-12H,4,7-10H2,1-3H3,(H,20,21,22) |
| InChIKey | WBYAJFKLFUYEFO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.33 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |