C22H27N5O — CID 112871445
6-N-(furan-2-ylmethyl)-2-methyl-4-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidine-4,6-diamine (PubChem CID 112871445) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 6-N-(furan-2-ylmethyl)-2-methyl-4-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidine-4,6-diamine.
| Compound Name | 6-N-(furan-2-ylmethyl)-2-methyl-4-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112871445 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 6-N-(furan-2-ylmethyl)-2-methyl-4-N-[4-(4-methylpiperidin-1-yl)phenyl]pyrimidine-4,6-diamine |
| SMILES | Cc1nc(NCc2ccco2)cc(Nc2ccc(N3CCC(C)CC3)cc2)n1 |
| InChI | InChI=1S/C22H27N5O/c1-16-9-11-27(12-10-16)19-7-5-18(6-8-19)26-22-14-21(24-17(2)25-22)23-15-20-4-3-13-28-20/h3-8,13-14,16H,9-12,15H2,1-2H3,(H2,23,24,25,26) |
| InChIKey | MLOHWYOBCMTGSY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 66.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|