C20H22N4O2 — CID 112871595
6-N-benzyl-4-N-(2,5-dimethoxyphenyl)-2-methylpyrimidine-4,6-diamine (PubChem CID 112871595) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 6-N-benzyl-4-N-(2,5-dimethoxyphenyl)-2-methylpyrimidine-4,6-diamine.
| Compound Name | 6-N-benzyl-4-N-(2,5-dimethoxyphenyl)-2-methylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112871595 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 6-N-benzyl-4-N-(2,5-dimethoxyphenyl)-2-methylpyrimidine-4,6-diamine |
| SMILES | COc1ccc(OC)c(Nc2cc(NCc3ccccc3)nc(C)n2)c1 |
| InChI | InChI=1S/C20H22N4O2/c1-14-22-19(21-13-15-7-5-4-6-8-15)12-20(23-14)24-17-11-16(25-2)9-10-18(17)26-3/h4-12H,13H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | CXWSTWUBXFAWSP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |