C13H17NO — CID 11287165
(4aS)-1,2,3,4,4a,8,9,10-octahydrobenzo[c]quinolizin-7-one (PubChem CID 11287165) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is (4aS)-1,2,3,4,4a,8,9,10-octahydrobenzo[c]quinolizin-7-one.
| Compound Name | (4aS)-1,2,3,4,4a,8,9,10-octahydrobenzo[c]quinolizin-7-one |
|---|---|
| PubChem CID | 11287165 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | (4aS)-1,2,3,4,4a,8,9,10-octahydrobenzo[c]quinolizin-7-one |
| SMILES | O=C1CCCC2=C1C=C[C@@H]1CCCCN21 |
| InChI | InChI=1S/C13H17NO/c15-13-6-3-5-12-11(13)8-7-10-4-1-2-9-14(10)12/h7-8,10H,1-6,9H2/t10-/m0/s1 |
| InChIKey | BQDJBANSBJFRQZ-JTQLQIEISA-N |
| XLogP | 2.42 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |