C21H24N4 — CID 112871781
2-methyl-4-N,6-N-bis[(3-methylphenyl)methyl]pyrimidine-4,6-diamine (PubChem CID 112871781) has the molecular formula C21H24N4 and a molecular weight of 332.45 g/mol. Its IUPAC name is 2-methyl-4-N,6-N-bis[(3-methylphenyl)methyl]pyrimidine-4,6-diamine.
| Compound Name | 2-methyl-4-N,6-N-bis[(3-methylphenyl)methyl]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112871781 |
| Molecular Formula | C21H24N4 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 2-methyl-4-N,6-N-bis[(3-methylphenyl)methyl]pyrimidine-4,6-diamine |
| SMILES | Cc1cccc(CNc2cc(NCc3cccc(C)c3)nc(C)n2)c1 |
| InChI | InChI=1S/C21H24N4/c1-15-6-4-8-18(10-15)13-22-20-12-21(25-17(3)24-20)23-14-19-9-5-7-16(2)11-19/h4-12H,13-14H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | VHQRHCSAIBXGCF-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |