C11H13NO3 — CID 11287230
(3R,5S,9R,11S)-7-hydroxy-4,10-dioxatetracyclo[5.5.0.03,5.09,11]dodecane-1-carbonitrile (PubChem CID 11287230) has the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. Its IUPAC name is (3R,5S,9R,11S)-7-hydroxy-4,10-dioxatetracyclo[5.5.0.03,5.09,11]dodecane-1-carbonitrile.
| Compound Name | (3R,5S,9R,11S)-7-hydroxy-4,10-dioxatetracyclo[5.5.0.03,5.09,11]dodecane-1-carbonitrile |
|---|---|
| PubChem CID | 11287230 |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (3R,5S,9R,11S)-7-hydroxy-4,10-dioxatetracyclo[5.5.0.03,5.09,11]dodecane-1-carbonitrile |
| SMILES | N#CC12C[C@@H]3O[C@@H]3CC1(O)C[C@@H]1O[C@@H]1C2 |
| InChI | InChI=1S/C11H13NO3/c12-5-10-1-6-8(14-6)3-11(10,13)4-9-7(2-10)15-9/h6-9,13H,1-4H2/t6-,7+,8+,9-,10?,11? |
| InChIKey | CFFQVSOPZMCXFB-ZATVTJCYSA-N |
| XLogP | 0.35 |
| TPSA | 69.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|