C24H27FN4 — CID 112872484
6-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-2-methylpyrimidin-4-amine (PubChem CID 112872484) has the molecular formula C24H27FN4 and a molecular weight of 390.51 g/mol. Its IUPAC name is 6-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-2-methylpyrimidin-4-amine.
| Compound Name | 6-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112872484 |
| Molecular Formula | C24H27FN4 |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 6-(4-benzylpiperidin-1-yl)-N-[(4-fluorophenyl)methyl]-2-methylpyrimidin-4-amine |
| SMILES | Cc1nc(NCc2ccc(F)cc2)cc(N2CCC(Cc3ccccc3)CC2)n1 |
| InChI | InChI=1S/C24H27FN4/c1-18-27-23(26-17-21-7-9-22(25)10-8-21)16-24(28-18)29-13-11-20(12-14-29)15-19-5-3-2-4-6-19/h2-10,16,20H,11-15,17H2,1H3,(H,26,27,28) |
| InChIKey | NHWZSSKKBKFUJH-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |