C12H26OSi — CID 11287356
2,6-dimethylhept-5-enoxy(trimethyl)silane (PubChem CID 11287356) has the molecular formula C12H26OSi and a molecular weight of 214.42 g/mol. Its IUPAC name is 2,6-dimethylhept-5-enoxy(trimethyl)silane.
| Compound Name | 2,6-dimethylhept-5-enoxy(trimethyl)silane |
|---|---|
| PubChem CID | 11287356 |
| Molecular Formula | C12H26OSi |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2,6-dimethylhept-5-enoxy(trimethyl)silane |
| SMILES | CC(C)=CCCC(C)CO[Si](C)(C)C |
| InChI | InChI=1S/C12H26OSi/c1-11(2)8-7-9-12(3)10-13-14(4,5)6/h8,12H,7,9-10H2,1-6H3 |
| InChIKey | IYHNEDFFZPUSGH-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|