6-oxo-6-pentoxyhexanoic acid

C11H20O4 — CID 11287381

IUPAC6-oxo-6-pentoxyhexanoic acid
SMILESCCCCCOC(=O)CCCCC(=O)O
InChIInChI=1S/C11H20O4/c1-2-3-6-9-15-11(14)8-5-4-7-10(12)13/h2-9H2,1H3,(H,12,13)
InChIKeyXMOUOZUUJHDLSN-UHFFFAOYSA-N
MW216.28 g/mol
LogP2.36
Rot. Bonds9

About 6-oxo-6-pentoxyhexanoic acid

6-oxo-6-pentoxyhexanoic acid (PubChem CID 11287381) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 6-oxo-6-pentoxyhexanoic acid.

Molecular Properties

Compound Name6-oxo-6-pentoxyhexanoic acid
PubChem CID11287381
Molecular FormulaC11H20O4
Molecular Weight216.28 g/mol
Exact Mass216.14
IUPAC Name6-oxo-6-pentoxyhexanoic acid
SMILESCCCCCOC(=O)CCCCC(=O)O
InChIInChI=1S/C11H20O4/c1-2-3-6-9-15-11(14)8-5-4-7-10(12)13/h2-9H2,1H3,(H,12,13)
InChIKeyXMOUOZUUJHDLSN-UHFFFAOYSA-N
XLogP2.36
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.28
LogP ≤ 52.36
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-oxo-6-pentoxyhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-oxo-6-pentoxyhexanoic acid?
The IUPAC name of 6-oxo-6-pentoxyhexanoic acid (CID 11287381) is 6-oxo-6-pentoxyhexanoic acid.
What is the SMILES notation for 6-oxo-6-pentoxyhexanoic acid?
The canonical SMILES for 6-oxo-6-pentoxyhexanoic acid is CCCCCOC(=O)CCCCC(=O)O.
What is the InChIKey of 6-oxo-6-pentoxyhexanoic acid?
The InChIKey is XMOUOZUUJHDLSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O4/c1-2-3-6-9-15-11(14)8-5-4-7-10(12)13/h2-9H2,1H3,(H,12,13).
What are the key properties of 6-oxo-6-pentoxyhexanoic acid?
6-oxo-6-pentoxyhexanoic acid has a molecular weight of 216.28 g/mol, XLogP of 2.36, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxo-6-pentoxyhexanoic acid is sourced from PubChem (CID 11287381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).