About 4-(4-butoxyphenyl)-1,3-oxazole
4-(4-butoxyphenyl)-1,3-oxazole (PubChem CID 11287393) has the molecular formula C13H15NO2
and a molecular weight of 217.27 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 4-(4-butoxyphenyl)-1,3-oxazole |
| PubChem CID | 11287393 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4-(4-butoxyphenyl)-1,3-oxazole |
| SMILES | CCCCOc1ccc(-c2cocn2)cc1 |
| InChI | InChI=1S/C13H15NO2/c1-2-3-8-16-12-6-4-11(5-7-12)13-9-15-10-14-13/h4-7,9-10H,2-3,8H2,1H3 |
| InChIKey | LSDRRJJMBIDABR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-butoxyphenyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-butoxyphenyl)-1,3-oxazole?
The IUPAC name of 4-(4-butoxyphenyl)-1,3-oxazole (CID 11287393) is 4-(4-butoxyphenyl)-1,3-oxazole.
What is the SMILES notation for 4-(4-butoxyphenyl)-1,3-oxazole?
The canonical SMILES for 4-(4-butoxyphenyl)-1,3-oxazole is CCCCOc1ccc(-c2cocn2)cc1.
What is the InChIKey of 4-(4-butoxyphenyl)-1,3-oxazole?
The InChIKey is LSDRRJJMBIDABR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15NO2/c1-2-3-8-16-12-6-4-11(5-7-12)13-9-15-10-14-13/h4-7,9-10H,2-3,8H2,1H3.
What are the key properties of 4-(4-butoxyphenyl)-1,3-oxazole?
4-(4-butoxyphenyl)-1,3-oxazole has a molecular weight of 217.27 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-butoxyphenyl)-1,3-oxazole is sourced from PubChem (CID 11287393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).