C22H24FN5O — CID 112875375
N-(2-fluorophenyl)-6-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylpyrimidin-4-amine (PubChem CID 112875375) has the molecular formula C22H24FN5O and a molecular weight of 393.47 g/mol. Its IUPAC name is N-(2-fluorophenyl)-6-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylpyrimidin-4-amine.
| Compound Name | N-(2-fluorophenyl)-6-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112875375 |
| Molecular Formula | C22H24FN5O |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.20 |
| IUPAC Name | N-(2-fluorophenyl)-6-[4-(2-methoxyphenyl)piperazin-1-yl]-2-methylpyrimidin-4-amine |
| SMILES | COc1ccccc1N1CCN(c2cc(Nc3ccccc3F)nc(C)n2)CC1 |
| InChI | InChI=1S/C22H24FN5O/c1-16-24-21(26-18-8-4-3-7-17(18)23)15-22(25-16)28-13-11-27(12-14-28)19-9-5-6-10-20(19)29-2/h3-10,15H,11-14H2,1-2H3,(H,24,25,26) |
| InChIKey | WNMSULNQWFABMI-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 53.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |