About methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate
methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate (PubChem CID 11287600) has the molecular formula C12H21NO3
and a molecular weight of 227.30 g/mol. Its IUPAC name is methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate.
Molecular Properties
| Compound Name | methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate |
| PubChem CID | 11287600 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate |
| SMILES | C=CCNCC(C)(C)/C=C(\OC)C(=O)OC |
| InChI | InChI=1S/C12H21NO3/c1-6-7-13-9-12(2,3)8-10(15-4)11(14)16-5/h6,8,13H,1,7,9H2,2-5H3/b10-8- |
| InChIKey | XQCHGUPJUKGEHN-NTMALXAHSA-N |
| XLogP | 1.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate?
The IUPAC name of methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate (CID 11287600) is methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate.
What is the SMILES notation for methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate?
The canonical SMILES for methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate is C=CCNCC(C)(C)/C=C(\OC)C(=O)OC.
What is the InChIKey of methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate?
The InChIKey is XQCHGUPJUKGEHN-NTMALXAHSA-N. The full InChI is InChI=1S/C12H21NO3/c1-6-7-13-9-12(2,3)8-10(15-4)11(14)16-5/h6,8,13H,1,7,9H2,2-5H3/b10-8-.
What are the key properties of methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate?
methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate has a molecular weight of 227.30 g/mol, XLogP of 1.49, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate is sourced from PubChem (CID 11287600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).