C12H21NO3 — CID 11287600
methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate (PubChem CID 11287600) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate.
| Compound Name | methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate |
|---|---|
| PubChem CID | 11287600 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | methyl (Z)-2-methoxy-4,4-dimethyl-5-(prop-2-enylamino)pent-2-enoate |
| SMILES | C=CCNCC(C)(C)/C=C(\OC)C(=O)OC |
| InChI | InChI=1S/C12H21NO3/c1-6-7-13-9-12(2,3)8-10(15-4)11(14)16-5/h6,8,13H,1,7,9H2,2-5H3/b10-8- |
| InChIKey | XQCHGUPJUKGEHN-NTMALXAHSA-N |
| XLogP | 1.49 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|