About 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol
2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol (PubChem CID 11287698) has the molecular formula C14H10F2O
and a molecular weight of 232.23 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol.
Molecular Properties
| Compound Name | 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol |
| PubChem CID | 11287698 |
| Molecular Formula | C14H10F2O |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol |
| SMILES | Oc1ccccc1/C=C/c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H10F2O/c15-12-8-6-10(9-13(12)16)5-7-11-3-1-2-4-14(11)17/h1-9,17H/b7-5+ |
| InChIKey | ZTWNLNYJDCMSFF-FNORWQNLSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol?
The IUPAC name of 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol (CID 11287698) is 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol.
What is the SMILES notation for 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol?
The canonical SMILES for 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol is Oc1ccccc1/C=C/c1ccc(F)c(F)c1.
What is the InChIKey of 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol?
The InChIKey is ZTWNLNYJDCMSFF-FNORWQNLSA-N. The full InChI is InChI=1S/C14H10F2O/c15-12-8-6-10(9-13(12)16)5-7-11-3-1-2-4-14(11)17/h1-9,17H/b7-5+.
What are the key properties of 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol?
2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol has a molecular weight of 232.23 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(3,4-difluorophenyl)ethenyl]phenol is sourced from PubChem (CID 11287698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).