C14H16O3 — CID 11287707
(1S,2R,3R,6S,7S,8R)-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione (PubChem CID 11287707) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (1S,2R,3R,6S,7S,8R)-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione.
| Compound Name | (1S,2R,3R,6S,7S,8R)-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione |
|---|---|
| PubChem CID | 11287707 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (1S,2R,3R,6S,7S,8R)-11-oxapentacyclo[6.5.1.13,6.02,7.09,13]pentadecane-10,12-dione |
| SMILES | O=C1OC(=O)C2C1[C@H]1C[C@@H]2[C@@H]2[C@H]3CC[C@H](C3)[C@@H]21 |
| InChI | InChI=1S/C14H16O3/c15-13-11-7-4-8(12(11)14(16)17-13)10-6-2-1-5(3-6)9(7)10/h5-12H,1-4H2/t5-,6+,7+,8-,9-,10+,11?,12? |
| InChIKey | OWRCHUBQUXRSJT-KRFXLWKESA-N |
| XLogP | 1.61 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|