About 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol
3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol (PubChem CID 1128773) has the molecular formula C17H17Br2NO4
and a molecular weight of 459.13 g/mol. Its IUPAC name is 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol.
Molecular Properties
| Compound Name | 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol |
| PubChem CID | 1128773 |
| Molecular Formula | C17H17Br2NO4 |
| Molecular Weight | 459.13 g/mol |
| Exact Mass | 456.95 |
| IUPAC Name | 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol |
| SMILES | CCOc1cc(Br)c(Br)c(/C=N/c2ccc(OC)c(OC)c2)c1O |
| InChI | InChI=1S/C17H17Br2NO4/c1-4-24-15-8-12(18)16(19)11(17(15)21)9-20-10-5-6-13(22-2)14(7-10)23-3/h5-9,21H,4H2,1-3H3/b20-9+ |
| InChIKey | NJUIRLYUTXPIQK-AWQFTUOYSA-N |
| XLogP | 5.08 |
| TPSA | 60.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.13 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol?
The IUPAC name of 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol (CID 1128773) is 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol.
What is the SMILES notation for 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol?
The canonical SMILES for 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol is CCOc1cc(Br)c(Br)c(/C=N/c2ccc(OC)c(OC)c2)c1O.
What is the InChIKey of 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol?
The InChIKey is NJUIRLYUTXPIQK-AWQFTUOYSA-N. The full InChI is InChI=1S/C17H17Br2NO4/c1-4-24-15-8-12(18)16(19)11(17(15)21)9-20-10-5-6-13(22-2)14(7-10)23-3/h5-9,21H,4H2,1-3H3/b20-9+.
What are the key properties of 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol?
3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol has a molecular weight of 459.13 g/mol, XLogP of 5.08, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dibromo-2-[(3,4-dimethoxyphenyl)iminomethyl]-6-ethoxyphenol is sourced from PubChem (CID 1128773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).