About 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate
5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (PubChem CID 11287880) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
Molecular Properties
| Compound Name | 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| PubChem CID | 11287880 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate |
| SMILES | C=CCOC(=O)N1CC(C(=O)OC)=CC[C@@H]1C |
| InChI | InChI=1S/C12H17NO4/c1-4-7-17-12(15)13-8-10(11(14)16-3)6-5-9(13)2/h4,6,9H,1,5,7-8H2,2-3H3/t9-/m0/s1 |
| InChIKey | SDPFNSSRADGCID-VIFPVBQESA-N |
| XLogP | 1.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The IUPAC name of 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate (CID 11287880) is 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate.
What is the SMILES notation for 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The canonical SMILES for 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate is C=CCOC(=O)N1CC(C(=O)OC)=CC[C@@H]1C.
What is the InChIKey of 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
The InChIKey is SDPFNSSRADGCID-VIFPVBQESA-N. The full InChI is InChI=1S/C12H17NO4/c1-4-7-17-12(15)13-8-10(11(14)16-3)6-5-9(13)2/h4,6,9H,1,5,7-8H2,2-3H3/t9-/m0/s1.
What are the key properties of 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate?
5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate has a molecular weight of 239.27 g/mol, XLogP of 1.50, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-methyl 1-O-prop-2-enyl (2S)-2-methyl-3,6-dihydro-2H-pyridine-1,5-dicarboxylate is sourced from PubChem (CID 11287880), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).