About 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol
3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol (PubChem CID 11288025) has the molecular formula C13H16N4O
and a molecular weight of 244.30 g/mol. Its IUPAC name is 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol.
Molecular Properties
| Compound Name | 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol |
| PubChem CID | 11288025 |
| Molecular Formula | C13H16N4O |
| Molecular Weight | 244.30 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol |
| SMILES | Nc1nc(N)c(-c2ccccc2)c(CCCO)n1 |
| InChI | InChI=1S/C13H16N4O/c14-12-11(9-5-2-1-3-6-9)10(7-4-8-18)16-13(15)17-12/h1-3,5-6,18H,4,7-8H2,(H4,14,15,16,17) |
| InChIKey | YZNAOFOUJPSQCR-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 98.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol?
The IUPAC name of 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol (CID 11288025) is 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol.
What is the SMILES notation for 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol?
The canonical SMILES for 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol is Nc1nc(N)c(-c2ccccc2)c(CCCO)n1.
What is the InChIKey of 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol?
The InChIKey is YZNAOFOUJPSQCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N4O/c14-12-11(9-5-2-1-3-6-9)10(7-4-8-18)16-13(15)17-12/h1-3,5-6,18H,4,7-8H2,(H4,14,15,16,17).
What are the key properties of 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol?
3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol has a molecular weight of 244.30 g/mol, XLogP of 1.23, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-diamino-5-phenylpyrimidin-4-yl)propan-1-ol is sourced from PubChem (CID 11288025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).