C17H19N5O2 — CID 112880373
6-N-(2-methoxyethyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylpyrimidine-4,6-diamine (PubChem CID 112880373) has the molecular formula C17H19N5O2 and a molecular weight of 325.37 g/mol. Its IUPAC name is 6-N-(2-methoxyethyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylpyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-methoxyethyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 112880373 |
| Molecular Formula | C17H19N5O2 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 6-N-(2-methoxyethyl)-4-N-(5-methyl-1,2-oxazol-3-yl)-2-phenylpyrimidine-4,6-diamine |
| SMILES | COCCNc1cc(Nc2cc(C)on2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H19N5O2/c1-12-10-16(22-24-12)19-15-11-14(18-8-9-23-2)20-17(21-15)13-6-4-3-5-7-13/h3-7,10-11H,8-9H2,1-2H3,(H2,18,19,20,21,22) |
| InChIKey | IGYNAHNXHNLLGM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|