C16H12N2O — CID 11288114
9-amino-6,11-dihydroindeno[1,2-c]isoquinolin-5-one (PubChem CID 11288114) has the molecular formula C16H12N2O and a molecular weight of 248.29 g/mol. Its IUPAC name is 9-amino-6,11-dihydroindeno[1,2-c]isoquinolin-5-one.
| Compound Name | 9-amino-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
|---|---|
| PubChem CID | 11288114 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 9-amino-6,11-dihydroindeno[1,2-c]isoquinolin-5-one |
| SMILES | Nc1ccc2c(c1)Cc1c-2[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C16H12N2O/c17-10-5-6-11-9(7-10)8-14-12-3-1-2-4-13(12)16(19)18-15(11)14/h1-7H,8,17H2,(H,18,19) |
| InChIKey | BIBLEFNXUYTZIB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|