C22H25N5 — CID 112881321
6-(azepan-1-yl)-2-phenyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine (PubChem CID 112881321) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is 6-(azepan-1-yl)-2-phenyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-(azepan-1-yl)-2-phenyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 112881321 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 6-(azepan-1-yl)-2-phenyl-N-(pyridin-2-ylmethyl)pyrimidin-4-amine |
| SMILES | c1ccc(-c2nc(NCc3ccccn3)cc(N3CCCCCC3)n2)cc1 |
| InChI | InChI=1S/C22H25N5/c1-2-9-15-27(14-8-1)21-16-20(24-17-19-12-6-7-13-23-19)25-22(26-21)18-10-4-3-5-11-18/h3-7,10-13,16H,1-2,8-9,14-15,17H2,(H,24,25,26) |
| InChIKey | BSYYESAPPQIHCL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |