C14H17BrN4 — CID 112881854
2-N-(3-bromo-4-methylphenyl)-4-N-propylpyrimidine-2,4-diamine (PubChem CID 112881854) has the molecular formula C14H17BrN4 and a molecular weight of 321.22 g/mol. Its IUPAC name is 2-N-(3-bromo-4-methylphenyl)-4-N-propylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-bromo-4-methylphenyl)-4-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112881854 |
| Molecular Formula | C14H17BrN4 |
| Molecular Weight | 321.22 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 2-N-(3-bromo-4-methylphenyl)-4-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCNc1ccnc(Nc2ccc(C)c(Br)c2)n1 |
| InChI | InChI=1S/C14H17BrN4/c1-3-7-16-13-6-8-17-14(19-13)18-11-5-4-10(2)12(15)9-11/h4-6,8-9H,3,7H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | ACXOLRQKZFIIFH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.22 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |