C15H26O3 — CID 11288276
(2R)-2-[(2R,4aR,8aS)-8a-hydroxy-4a-methyl-8-methylidene-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propane-1,2-diol (PubChem CID 11288276) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (2R)-2-[(2R,4aR,8aS)-8a-hydroxy-4a-methyl-8-methylidene-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propane-1,2-diol.
| Compound Name | (2R)-2-[(2R,4aR,8aS)-8a-hydroxy-4a-methyl-8-methylidene-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 11288276 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (2R)-2-[(2R,4aR,8aS)-8a-hydroxy-4a-methyl-8-methylidene-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl]propane-1,2-diol |
| SMILES | C=C1CCC[C@]2(C)CC[C@@H]([C@@](C)(O)CO)C[C@]12O |
| InChI | InChI=1S/C15H26O3/c1-11-5-4-7-13(2)8-6-12(9-15(11,13)18)14(3,17)10-16/h12,16-18H,1,4-10H2,2-3H3/t12-,13-,14+,15+/m1/s1 |
| InChIKey | UJAAZUOEEYZOLC-KBXIAJHMSA-N |
| XLogP | 2.01 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|