C15H16N4O2 — CID 112882760
methyl 4-[[2-(prop-2-enylamino)pyrimidin-4-yl]amino]benzoate (PubChem CID 112882760) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is methyl 4-[[2-(prop-2-enylamino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | methyl 4-[[2-(prop-2-enylamino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 112882760 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | methyl 4-[[2-(prop-2-enylamino)pyrimidin-4-yl]amino]benzoate |
| SMILES | C=CCNc1nccc(Nc2ccc(C(=O)OC)cc2)n1 |
| InChI | InChI=1S/C15H16N4O2/c1-3-9-16-15-17-10-8-13(19-15)18-12-6-4-11(5-7-12)14(20)21-2/h3-8,10H,1,9H2,2H3,(H2,16,17,18,19) |
| InChIKey | KSRSOOQLFJJFNZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|