C13H22N4O — CID 112882998
2-N-butyl-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 112882998) has the molecular formula C13H22N4O and a molecular weight of 250.35 g/mol. Its IUPAC name is 2-N-butyl-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-butyl-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112882998 |
| Molecular Formula | C13H22N4O |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.18 |
| IUPAC Name | 2-N-butyl-4-N-(oxolan-2-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | CCCCNc1nccc(NCC2CCCO2)n1 |
| InChI | InChI=1S/C13H22N4O/c1-2-3-7-14-13-15-8-6-12(17-13)16-10-11-5-4-9-18-11/h6,8,11H,2-5,7,9-10H2,1H3,(H2,14,15,16,17) |
| InChIKey | DPOSYQTXUCURRH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|