C18H24N4O — CID 112884339
2-N-cyclopentyl-4-N-[2-(2-methoxyphenyl)ethyl]pyrimidine-2,4-diamine (PubChem CID 112884339) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 2-N-cyclopentyl-4-N-[2-(2-methoxyphenyl)ethyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-cyclopentyl-4-N-[2-(2-methoxyphenyl)ethyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112884339 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 2-N-cyclopentyl-4-N-[2-(2-methoxyphenyl)ethyl]pyrimidine-2,4-diamine |
| SMILES | COc1ccccc1CCNc1ccnc(NC2CCCC2)n1 |
| InChI | InChI=1S/C18H24N4O/c1-23-16-9-5-2-6-14(16)10-12-19-17-11-13-20-18(22-17)21-15-7-3-4-8-15/h2,5-6,9,11,13,15H,3-4,7-8,10,12H2,1H3,(H2,19,20,21,22) |
| InChIKey | VREGCCIGSSZSDO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |