C15H16ClFN4 — CID 112884544
N-(3-chloro-4-fluorophenyl)-4-piperidin-1-ylpyrimidin-2-amine (PubChem CID 112884544) has the molecular formula C15H16ClFN4 and a molecular weight of 306.77 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-piperidin-1-ylpyrimidin-2-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-piperidin-1-ylpyrimidin-2-amine |
|---|---|
| PubChem CID | 112884544 |
| Molecular Formula | C15H16ClFN4 |
| Molecular Weight | 306.77 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-piperidin-1-ylpyrimidin-2-amine |
| SMILES | Fc1ccc(Nc2nccc(N3CCCCC3)n2)cc1Cl |
| InChI | InChI=1S/C15H16ClFN4/c16-12-10-11(4-5-13(12)17)19-15-18-7-6-14(20-15)21-8-2-1-3-9-21/h4-7,10H,1-3,8-9H2,(H,18,19,20) |
| InChIKey | OQWGIBXZCZUVEE-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.77 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |