C18H24N4 — CID 112885068
N-[(2-methylphenyl)methyl]-4-(4-methylpiperidin-1-yl)pyrimidin-2-amine (PubChem CID 112885068) has the molecular formula C18H24N4 and a molecular weight of 296.42 g/mol. Its IUPAC name is N-[(2-methylphenyl)methyl]-4-(4-methylpiperidin-1-yl)pyrimidin-2-amine.
| Compound Name | N-[(2-methylphenyl)methyl]-4-(4-methylpiperidin-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 112885068 |
| Molecular Formula | C18H24N4 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-[(2-methylphenyl)methyl]-4-(4-methylpiperidin-1-yl)pyrimidin-2-amine |
| SMILES | Cc1ccccc1CNc1nccc(N2CCC(C)CC2)n1 |
| InChI | InChI=1S/C18H24N4/c1-14-8-11-22(12-9-14)17-7-10-19-18(21-17)20-13-16-6-4-3-5-15(16)2/h3-7,10,14H,8-9,11-13H2,1-2H3,(H,19,20,21) |
| InChIKey | SLJQRSXMXSOHAR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |