C16H18N4O3 — CID 112886492
methyl 4-[(4-morpholin-4-ylpyrimidin-2-yl)amino]benzoate (PubChem CID 112886492) has the molecular formula C16H18N4O3 and a molecular weight of 314.35 g/mol. Its IUPAC name is methyl 4-[(4-morpholin-4-ylpyrimidin-2-yl)amino]benzoate.
| Compound Name | methyl 4-[(4-morpholin-4-ylpyrimidin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 112886492 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | methyl 4-[(4-morpholin-4-ylpyrimidin-2-yl)amino]benzoate |
| SMILES | COC(=O)c1ccc(Nc2nccc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C16H18N4O3/c1-22-15(21)12-2-4-13(5-3-12)18-16-17-7-6-14(19-16)20-8-10-23-11-9-20/h2-7H,8-11H2,1H3,(H,17,18,19) |
| InChIKey | ZIGGRGKYLUUYIC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |