C17H22N4O2 — CID 112886567
N-[2-(4-methoxyphenyl)ethyl]-2-morpholin-4-ylpyrimidin-4-amine (PubChem CID 112886567) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is N-[2-(4-methoxyphenyl)ethyl]-2-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | N-[2-(4-methoxyphenyl)ethyl]-2-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 112886567 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-[2-(4-methoxyphenyl)ethyl]-2-morpholin-4-ylpyrimidin-4-amine |
| SMILES | COc1ccc(CCNc2ccnc(N3CCOCC3)n2)cc1 |
| InChI | InChI=1S/C17H22N4O2/c1-22-15-4-2-14(3-5-15)6-8-18-16-7-9-19-17(20-16)21-10-12-23-13-11-21/h2-5,7,9H,6,8,10-13H2,1H3,(H,18,19,20) |
| InChIKey | ZBVJPBLZGBAPKC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |