C17H23N5O2 — CID 112887597
2-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine (PubChem CID 112887597) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112887597 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 2-N-(1,3-benzodioxol-5-ylmethyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine |
| SMILES | CN(C)CCCNc1ccnc(NCc2ccc3c(c2)OCO3)n1 |
| InChI | InChI=1S/C17H23N5O2/c1-22(2)9-3-7-18-16-6-8-19-17(21-16)20-11-13-4-5-14-15(10-13)24-12-23-14/h4-6,8,10H,3,7,9,11-12H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | BPDJDTXUXAZSFU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 71.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|