C19H20N4O — CID 112889503
4-N-benzyl-2-N-(2-methoxy-5-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 112889503) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is 4-N-benzyl-2-N-(2-methoxy-5-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-benzyl-2-N-(2-methoxy-5-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112889503 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 4-N-benzyl-2-N-(2-methoxy-5-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1ccc(C)cc1Nc1nccc(NCc2ccccc2)n1 |
| InChI | InChI=1S/C19H20N4O/c1-14-8-9-17(24-2)16(12-14)22-19-20-11-10-18(23-19)21-13-15-6-4-3-5-7-15/h3-12H,13H2,1-2H3,(H2,20,21,22,23) |
| InChIKey | PUEOIYYWBFYRMC-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |