About 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine
2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine (PubChem CID 112891014) has the molecular formula C19H20N4
and a molecular weight of 304.40 g/mol. Its IUPAC name is 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine |
| PubChem CID | 112891014 |
| Molecular Formula | C19H20N4 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine |
| SMILES | CN(Cc1ccccc1)c1nccc(N(C)c2ccccc2)n1 |
| InChI | InChI=1S/C19H20N4/c1-22(15-16-9-5-3-6-10-16)19-20-14-13-18(21-19)23(2)17-11-7-4-8-12-17/h3-14H,15H2,1-2H3 |
| InChIKey | PVILMMXPLKCNTJ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine?
The IUPAC name of 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine (CID 112891014) is 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine.
What is the SMILES notation for 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine?
The canonical SMILES for 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine is CN(Cc1ccccc1)c1nccc(N(C)c2ccccc2)n1.
What is the InChIKey of 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine?
The InChIKey is PVILMMXPLKCNTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4/c1-22(15-16-9-5-3-6-10-16)19-20-14-13-18(21-19)23(2)17-11-7-4-8-12-17/h3-14H,15H2,1-2H3.
What are the key properties of 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine?
2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine has a molecular weight of 304.40 g/mol, XLogP of 3.88, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-benzyl-2-N,4-N-dimethyl-4-N-phenylpyrimidine-2,4-diamine is sourced from PubChem (CID 112891014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).