About methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate
methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate (PubChem CID 11289223) has the molecular formula C13H20O3S2
and a molecular weight of 288.43 g/mol. Its IUPAC name is methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate.
Molecular Properties
| Compound Name | methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate |
| PubChem CID | 11289223 |
| Molecular Formula | C13H20O3S2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate |
| SMILES | COC(=O)CCCCCCCCc1csc(=O)s1 |
| InChI | InChI=1S/C13H20O3S2/c1-16-12(14)9-7-5-3-2-4-6-8-11-10-17-13(15)18-11/h10H,2-9H2,1H3 |
| InChIKey | JMYZQFHCFYSHCV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate?
The IUPAC name of methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate (CID 11289223) is methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate.
What is the SMILES notation for methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate?
The canonical SMILES for methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate is COC(=O)CCCCCCCCc1csc(=O)s1.
What is the InChIKey of methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate?
The InChIKey is JMYZQFHCFYSHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O3S2/c1-16-12(14)9-7-5-3-2-4-6-8-11-10-17-13(15)18-11/h10H,2-9H2,1H3.
What are the key properties of methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate?
methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate has a molecular weight of 288.43 g/mol, XLogP of 3.62, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 9-(2-oxo-1,3-dithiol-4-yl)nonanoate is sourced from PubChem (CID 11289223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).